CAS 731773-10-7

1-(2-bromoprop-2-enyl)-4-fluoro-benzene

Description:

1-(2-bromoprop-2-enyl)-4-fluoro-benzene, identified by its CAS number 731773-10-7, is an organic compound characterized by the presence of both bromine and fluorine substituents on a benzene ring. The structure features a prop-2-enyl group, which is a vinyl group with a bromine atom attached to the second carbon, contributing to its reactivity. The fluorine atom is located at the para position relative to the prop-2-enyl group on the benzene ring, influencing the compound's electronic properties and potentially its reactivity in various chemical reactions. This compound may exhibit unique physical properties such as specific boiling and melting points, solubility characteristics, and stability under different conditions. Its reactivity can be attributed to the presence of the halogen atoms, which can participate in nucleophilic substitution reactions or other transformations. Overall, 1-(2-bromoprop-2-enyl)-4-fluoro-benzene is of interest in synthetic organic chemistry and may have applications in pharmaceuticals or materials science due to its functional groups.

Formula: C₉H₈BrF

InChI: InChI=1/C9H8BrF/c1-7(10)6-8-2-4-9(11)5-3-8/h2-5H,1,6H2

SMILES: C=C(Cc1ccc(cc1)F)Br

Synonyms:

• 2-BROMO-3-(4-FLUOROPHENYL)-1-PROPENE
• Benzene, 1-(2-bromo-2-propen-1-yl)-4-fluoro-