CAS 731773-11-8

Benzene, 1-(3-bromo-3-buten-1-yl)-4-fluoro-

Description:

Benzene, 1-(3-bromo-3-buten-1-yl)-4-fluoro-, also known by its CAS number 731773-11-8, is an organic compound characterized by a benzene ring substituted with a 4-fluoro group and a 3-bromo-3-buten-1-yl side chain. The presence of the fluorine atom introduces unique electronic properties, potentially enhancing the compound's reactivity and influencing its interactions in various chemical environments. The bromoalkene substituent contributes to the compound's potential for undergoing nucleophilic substitution reactions, making it a candidate for further chemical transformations. This compound may exhibit distinct physical properties, such as specific boiling and melting points, solubility characteristics, and reactivity profiles, which are influenced by the functional groups present. Additionally, its structural features suggest potential applications in organic synthesis, pharmaceuticals, or materials science, where the unique properties of halogenated compounds are often exploited. As with many halogenated organic compounds, safety considerations regarding toxicity and environmental impact should be taken into account during handling and application.

Formula: C₁₀H₁₀BrF

InChI: InChI=1S/C10H10BrF/c1-8(11)2-3-9-4-6-10(12)7-5-9/h4-7H,1-3H2

InChI key: InChIKey=VCRZSRKDSUZVGJ-UHFFFAOYSA-N

SMILES: C(CC(Br)=C)C1=CC=C(F)C=C1

Synonyms:

• 1-(3-Bromobut-3-enyl)-4-fluorobenzene
• 2-Bromo-4-(4-fluorophenyl)-1-butene
• 1-(3-Bromobut-3-en-1-yl)-4-fluorobenzene
• Benzene, 1-(3-bromo-3-butenyl)-4-fluoro-
• Benzene, 1-(3-bromo-3-buten-1-yl)-4-fluoro-