CAS 731773-12-9
:1-fluoro-4-(3-methylbut-3-enyl)benzene
Description:
1-Fluoro-4-(3-methylbut-3-enyl)benzene, with the CAS number 731773-12-9, is an organic compound characterized by the presence of a fluorine atom and a substituted benzene ring. The structure features a fluoro group attached to the para position of a benzene ring, while a 3-methylbut-3-enyl group is connected to the benzene at the 4-position. This compound exhibits properties typical of aromatic compounds, such as stability due to resonance and potential reactivity due to the presence of the electron-withdrawing fluorine atom. The presence of the alkenyl side chain introduces unsaturation, which can lead to additional reactivity, particularly in electrophilic addition reactions. The compound may be of interest in various fields, including organic synthesis and materials science, due to its unique structural features. Its physical properties, such as boiling point, melting point, and solubility, would depend on the specific interactions of the functional groups present. Safety data and handling precautions should be consulted, as with any chemical substance.
Formula:C11H13F
InChI:InChI=1/C11H13F/c1-9(2)3-4-10-5-7-11(12)8-6-10/h5-8H,1,3-4H2,2H3
SMILES:C=C(C)CCc1ccc(cc1)F
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.