CymitQuimica logo

CAS 731773-14-1

:

1-(2-bromoprop-2-enyl)-2-methoxy-benzene

Description:
1-(2-bromoprop-2-enyl)-2-methoxy-benzene, also known by its CAS number 731773-14-1, is an organic compound characterized by its aromatic structure, which includes a methoxy group (-OCH3) and a bromopropenyl substituent. The presence of the bromine atom introduces notable reactivity, making it a potential candidate for various chemical transformations, such as nucleophilic substitutions or coupling reactions. The methoxy group enhances the electron density of the aromatic ring, influencing its reactivity and stability. This compound may exhibit moderate to high lipophilicity due to its hydrophobic aromatic system, which can affect its solubility in organic solvents. Additionally, the compound's structure suggests potential applications in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals. Its unique combination of functional groups may also impart specific biological activities, warranting further investigation in medicinal chemistry. As with many brominated compounds, considerations regarding environmental impact and safety are essential during handling and application.
Formula:C10H11BrO
InChI:InChI=1/C10H11BrO/c1-8(11)7-9-5-3-4-6-10(9)12-2/h3-6H,1,7H2,2H3
InChI key:InChIKey=MKMZHQBTAFKEFC-UHFFFAOYSA-N
SMILES:C(C(Br)=C)C1=C(OC)C=CC=C1
Synonyms:
  • 1-(2-Bromo-2-propen-1-yl)-2-methoxybenzene
  • Benzene, 1-(2-bromo-2-propenyl)-2-methoxy-
  • Benzene, 1-(2-bromo-2-propen-1-yl)-2-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.