CAS 731773-15-2

1-(3-Bromo-3-buten-1-yl)-2-methoxybenzene

Description:

1-(3-Bromo-3-buten-1-yl)-2-methoxybenzene, identified by its CAS number 731773-15-2, is an organic compound characterized by the presence of a methoxy group and a bromoalkene substituent on a benzene ring. This compound features a substituted phenyl group, where the methoxy group (-OCH3) is positioned at the ortho position relative to the bromoalkene chain. The bromoalkene moiety contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and cross-coupling reactions. The presence of the bromine atom enhances its electrophilic character, while the butenyl group introduces a degree of unsaturation, which can influence its physical properties and reactivity. Typically, compounds of this nature may exhibit moderate to high polarity due to the methoxy group, affecting their solubility in organic solvents. Additionally, the compound may have applications in organic synthesis, medicinal chemistry, or materials science, depending on its specific reactivity and functional properties.

Formula: C₁₁H₁₃BrO

InChI: InChI=1S/C11H13BrO/c1-9(12)7-8-10-5-3-4-6-11(10)13-2/h3-6H,1,7-8H2,2H3

InChI key: InChIKey=UESMTWIQCSBWCS-UHFFFAOYSA-N

SMILES: C(CC(Br)=C)C1=C(OC)C=CC=C1

Synonyms:

• Benzene, 1-(3-bromo-3-butenyl)-2-methoxy-
• 1-(3-Bromo-3-buten-1-yl)-2-methoxybenzene
• Benzene, 1-(3-bromo-3-buten-1-yl)-2-methoxy-