CAS 731773-17-4

1-(3-Chloro-3-buten-1-yl)-3-methoxybenzene

Description:

1-(3-Chloro-3-buten-1-yl)-3-methoxybenzene, identified by its CAS number 731773-17-4, is an organic compound characterized by the presence of a methoxy group (-OCH3) attached to a benzene ring, along with a chloroalkene substituent. This compound features a butenyl chain that includes a chlorine atom, which contributes to its reactivity and potential applications in organic synthesis. The presence of the methoxy group enhances the electron density of the aromatic ring, influencing its reactivity in electrophilic aromatic substitution reactions. Additionally, the chloroalkene moiety can participate in various chemical reactions, such as nucleophilic substitutions or polymerization processes. The compound's structure suggests it may exhibit interesting biological activities, making it a candidate for further research in medicinal chemistry. Its physical properties, such as solubility and boiling point, would depend on the specific molecular interactions and the presence of functional groups, which can affect its behavior in different environments. Overall, this compound represents a versatile building block in organic synthesis and potential applications in pharmaceuticals.

Formula: C₁₁H₁₃ClO

InChI: InChI=1S/C11H13ClO/c1-9(12)6-7-10-4-3-5-11(8-10)13-2/h3-5,8H,1,6-7H2,2H3

InChI key: InChIKey=ILLDPHWRYXKEAN-UHFFFAOYSA-N

SMILES: C(CC(=C)Cl)C1=CC(OC)=CC=C1

Synonyms:

• Benzene, 1-(3-chloro-3-butenyl)-3-methoxy-
• Benzene, 1-(3-chloro-3-buten-1-yl)-3-methoxy-
• 1-(3-Chloro-3-buten-1-yl)-3-methoxybenzene