CAS 731773-19-6
:1-(3-chlorobut-3-enyl)-4-methoxy-benzene
Description:
1-(3-Chlorobut-3-enyl)-4-methoxy-benzene, identified by its CAS number 731773-19-6, is an organic compound characterized by the presence of a methoxy group (-OCH3) attached to a benzene ring and a chlorobut-3-enyl side chain. This compound features a conjugated system due to the presence of the double bond in the butenyl moiety, which can influence its reactivity and stability. The chlorine atom introduces a polar functional group, potentially affecting the compound's solubility and interaction with other molecules. The methoxy group is known to enhance the electron density on the aromatic ring, which can influence electrophilic substitution reactions. Additionally, the compound may exhibit interesting biological activities due to its structural features, making it a candidate for further research in medicinal chemistry. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific molecular interactions and the overall structure, which can be explored through experimental methods or computational chemistry approaches.
Formula:C11H13ClO
InChI:InChI=1/C11H13ClO/c1-9(12)3-4-10-5-7-11(13-2)8-6-10/h5-8H,1,3-4H2,2H3
SMILES:C=C(CCc1ccc(cc1)OC)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.