CymitQuimica logo

CAS 731773-20-9

:

1-(3-bromobut-3-enyl)-4-methoxy-benzene

Description:
1-(3-Bromobut-3-enyl)-4-methoxy-benzene, identified by its CAS number 731773-20-9, is an organic compound characterized by the presence of a bromobutene side chain and a methoxy group attached to a benzene ring. The structure features a conjugated system due to the presence of the double bond in the butene moiety, which can impart unique reactivity and stability characteristics. The bromine atom introduces a halogen functionality, making the compound potentially reactive in nucleophilic substitution reactions. The methoxy group, being an electron-donating substituent, can influence the electronic properties of the aromatic ring, enhancing its reactivity towards electrophilic aromatic substitution. This compound may exhibit moderate to high lipophilicity due to its hydrophobic aromatic and aliphatic components, which can affect its solubility in various solvents. Additionally, the presence of both the bromine and methoxy groups can lead to interesting interactions in biological systems, making it a candidate for further studies in medicinal chemistry or materials science.
Formula:C11H13BrO
InChI:InChI=1/C11H13BrO/c1-9(12)3-4-10-5-7-11(13-2)8-6-10/h5-8H,1,3-4H2,2H3
SMILES:C=C(CCc1ccc(cc1)OC)Br
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.