CAS 731773-21-0

6-Hepten-1-ol, 6-chloro-, 1-acetate

Description:

6-Hepten-1-ol, 6-chloro-, 1-acetate is an organic compound characterized by its structure, which includes a heptene backbone with a hydroxyl group and a chlorine atom at the sixth carbon position, along with an acetate functional group at the first carbon. This compound is likely to exhibit properties typical of alcohols and halogenated compounds, such as moderate polarity due to the hydroxyl group, which can engage in hydrogen bonding, and potential reactivity due to the presence of the chlorine atom. The acetate group suggests that it may participate in esterification reactions. Its molecular structure indicates that it may be a colorless to pale yellow liquid with a characteristic odor, and it may be soluble in organic solvents while having limited solubility in water. The presence of both a double bond and functional groups may also impart unique reactivity, making it of interest in synthetic organic chemistry and potential applications in pharmaceuticals or agrochemicals. Safety data should be consulted for handling and storage, as halogenated compounds can pose health risks.

Formula: C₉H₁₅ClO₂

InChI: InChI=1S/C9H15ClO2/c1-8(10)6-4-3-5-7-12-9(2)11/h1,3-7H2,2H3

InChI key: InChIKey=GUBBRBZSLJUYJT-UHFFFAOYSA-N

SMILES: C(CC(=C)Cl)CCCOC(C)=O

Synonyms:

• 6-Hepten-1-ol, 6-chloro-, 1-acetate
• 6-Hepten-1-ol, 6-chloro-, acetate