CAS 731773-22-1

7-Octen-1-ol, 7-chloro-, 1-acetate

Description:

7-Octen-1-ol, 7-chloro-, 1-acetate, with the CAS number 731773-22-1, is an organic compound characterized by its functional groups, including a chloro substituent and an acetate moiety. This compound features a long carbon chain, which contributes to its hydrophobic properties, while the presence of the hydroxyl group (alcohol) and the acetate group enhances its reactivity and solubility in polar solvents. The chloro group introduces additional reactivity, making it a potential candidate for various chemical reactions, such as nucleophilic substitutions. Typically, compounds like this may exhibit moderate volatility and can be used in organic synthesis or as intermediates in the production of more complex molecules. Its structural features suggest potential applications in the fragrance industry or as a building block in pharmaceuticals. However, specific safety and handling guidelines should be followed due to the presence of chlorine, which can pose health risks. Overall, 7-Octen-1-ol, 7-chloro-, 1-acetate is a versatile compound with unique chemical properties that warrant further exploration in various chemical applications.

Formula: C₁₀H₁₇ClO₂

InChI: InChI=1S/C10H17ClO2/c1-9(11)7-5-3-4-6-8-13-10(2)12/h1,3-8H2,2H3

InChI key: InChIKey=MSMQHFBWHMSHOF-UHFFFAOYSA-N

SMILES: C(CC(=C)Cl)CCCCOC(C)=O

Synonyms:

• 7-Octen-1-ol, 7-chloro-, 1-acetate
• 7-Octen-1-ol, 7-chloro-, acetate