CAS 731773-23-2
:6-bromohept-6-enyl acetate
Description:
6-Bromohept-6-enyl acetate is an organic compound characterized by its unique structure, which includes a bromine atom and an acetate functional group. As a derivative of heptene, it features a double bond located at the sixth carbon position, contributing to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic character, making it useful in various chemical reactions, such as nucleophilic substitutions. The acetate group provides a site for esterification reactions and can influence the compound's solubility and volatility. Typically, compounds like 6-bromohept-6-enyl acetate are utilized in the synthesis of more complex molecules, including pharmaceuticals and agrochemicals. Its physical properties, such as boiling point and solubility, can vary based on the molecular interactions and the presence of functional groups. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 6-bromohept-6-enyl acetate is a versatile compound in organic chemistry with significant potential for further research and application.
Formula:C9H15BrO2
InChI:InChI=1/C9H15BrO2/c1-8(10)6-4-3-5-7-12-9(2)11/h1,3-7H2,2H3
SMILES:C=C(CCCCCOC(=O)C)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.