CAS 731773-24-3
:7-bromooct-7-enyl acetate
Description:
7-Bromooct-7-enyl acetate is an organic compound characterized by its structure, which includes a bromine atom and an acetate functional group attached to an octene backbone. This compound features a double bond at the seventh carbon position, contributing to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic properties, making it useful in various chemical reactions, such as nucleophilic substitutions or coupling reactions. The acetate group provides a polar functional group that can influence solubility and reactivity. Typically, compounds like 7-bromooct-7-enyl acetate are utilized in the synthesis of more complex molecules in pharmaceutical and agrochemical research. Its physical properties, such as boiling point and solubility, would depend on the specific molecular interactions and the presence of the bromine and acetate groups. Safety data sheets should be consulted for handling and storage guidelines, as halogenated compounds can pose health and environmental risks.
Formula:C10H17BrO2
InChI:InChI=1/C10H17BrO2/c1-9(11)7-5-3-4-6-8-13-10(2)12/h1,3-8H2,2H3
SMILES:C=C(CCCCCCOC(=O)C)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.