CAS 731773-25-4
:6-methylhept-6-enyl acetate
Description:
6-Methylhept-6-enyl acetate is an organic compound characterized by its structure, which includes a heptene backbone with a methyl group and an acetate functional group. This compound features a double bond located at the sixth carbon of the heptane chain, contributing to its unsaturation. The presence of the acetate group indicates that it is an ester, which typically imparts fruity or floral aromas, making it relevant in flavor and fragrance applications. The molecular formula reflects its composition of carbon, hydrogen, and oxygen atoms, and its structure can influence its physical properties, such as boiling point and solubility. As a chemical substance, it may exhibit reactivity typical of alkenes and esters, including potential participation in addition reactions or hydrolysis. Its CAS number, 731773-25-4, allows for precise identification in chemical databases, facilitating research and application in various fields, including organic synthesis and industrial chemistry. Safety data should be consulted for handling and usage guidelines, as with any chemical substance.
Formula:C10H18O2
InChI:InChI=1/C10H18O2/c1-9(2)7-5-4-6-8-12-10(3)11/h1,4-8H2,2-3H3
SMILES:C=C(C)CCCCCOC(=O)C
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.