CAS 731773-27-6
:5-chlorohex-5-enoic acid
Description:
5-Chlorohex-5-enoic acid is an organic compound characterized by its unsaturated carboxylic acid structure, featuring a chlorine atom and a double bond within a six-carbon chain. The presence of the double bond at the fifth carbon position contributes to its reactivity, making it a potential candidate for various chemical reactions, such as addition reactions typical of alkenes. The carboxylic acid functional group (-COOH) imparts acidic properties, allowing it to participate in acid-base reactions and to form salts and esters. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. Its applications may include use in organic synthesis, as an intermediate in the production of pharmaceuticals, agrochemicals, or other specialty chemicals. Safety considerations are important, as the chlorine substituent can introduce toxicity and environmental concerns, necessitating careful handling and disposal. Overall, 5-chlorohex-5-enoic acid is a versatile compound with significant implications in synthetic organic chemistry.
Formula:C6H9ClO2
InChI:InChI=1/C6H9ClO2/c1-5(7)3-2-4-6(8)9/h1-4H2,(H,8,9)
SMILES:C=C(CCCC(=O)O)Cl
Synonyms:- 5-Chloro-hex-5-enoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.