CymitQuimica logo

CAS 731773-28-7

:

6-chlorohept-6-enoic acid

Description:
6-Chlorohept-6-enoic acid is an organic compound characterized by its structure, which includes a chlorinated alkene and a carboxylic acid functional group. The presence of the double bond in the heptene chain indicates that it has unsaturation, which can influence its reactivity and physical properties. The chlorine atom, located at the sixth carbon, contributes to the compound's polarity and can affect its solubility in various solvents. As a carboxylic acid, it exhibits typical acidic properties, including the ability to donate protons in solution. This compound may be used in organic synthesis and could serve as an intermediate in the production of more complex molecules. Its reactivity may be enhanced due to the combination of the double bond and the electron-withdrawing chlorine atom, making it a potential candidate for various chemical reactions, including nucleophilic additions and substitutions. Safety and handling precautions should be observed, as with many chlorinated compounds, due to potential toxicity and environmental concerns.
Formula:C7H11ClO2
InChI:InChI=1/C7H11ClO2/c1-6(8)4-2-3-5-7(9)10/h1-5H2,(H,9,10)
SMILES:C=C(CCCCC(=O)O)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.