CAS 731773-30-1
:8-Chloro-8-nonenoic acid
Description:
8-Chloro-8-nonenoic acid is an organic compound characterized by its unique structure, which includes a nonenoic acid backbone with a chlorine substituent at the eighth carbon position. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its reactivity due to the presence of both a carboxylic acid functional group and a double bond in its carbon chain, making it a candidate for various chemical reactions, including esterification and nucleophilic substitutions. The chlorine atom introduces additional polarity, which can influence its solubility in organic solvents and its interactions with other chemical species. 8-Chloro-8-nonenoic acid may be utilized in synthetic organic chemistry, particularly in the development of pharmaceuticals or agrochemicals. Safety data sheets should be consulted for handling precautions, as halogenated compounds can exhibit toxicity and environmental concerns. Overall, its unique structural features make it a valuable compound in chemical research and applications.
Formula:C9H15ClO2
InChI:InChI=1S/C9H15ClO2/c1-8(10)6-4-2-3-5-7-9(11)12/h1-7H2,(H,11,12)
InChI key:InChIKey=MCKURDXPLDUVNU-UHFFFAOYSA-N
SMILES:C(CC(=C)Cl)CCCCC(O)=O
Synonyms:- 8-Chloro-8-nonenoic acid
- 8-Nonenoic acid, 8-chloro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.