CAS 731776-49-1

2H-Thieno[3,2-e]-1,2,3-thiadiazine-6-carboxylic acid, 3,4-dihydro-5-methyl-4-oxo-, hydrazide, 1,1-dioxide

Description:

2H-Thieno[3,2-e]-1,2,3-thiadiazine-6-carboxylic acid, 3,4-dihydro-5-methyl-4-oxo-, hydrazide, 1,1-dioxide, identified by CAS number 731776-49-1, is a heterocyclic compound featuring a thieno-thiadiazine core structure. This compound is characterized by the presence of a thiadiazine ring fused with a thieno ring, which contributes to its unique chemical properties. The molecule contains a carboxylic acid functional group and a hydrazide moiety, indicating potential for reactivity and biological activity. The presence of the 1,1-dioxide functional group suggests that it may exhibit enhanced stability and solubility in various solvents. Additionally, the methyl and oxo substituents on the ring system may influence its pharmacological properties, making it of interest in medicinal chemistry. Overall, this compound's structural features suggest potential applications in drug development, particularly in areas targeting specific biological pathways or conditions. Further studies would be necessary to elucidate its specific properties and potential uses in various fields.

Formula: C₇H₈N₄O₄S₂

InChI: InChI=1S/C7H8N4O4S2/c1-2-3-5(12)10-11-17(14,15)7(3)16-4(2)6(13)9-8/h11H,8H2,1H3,(H,9,13)(H,10,12)

InChI key: InChIKey=HUXNNECBKVFIDM-UHFFFAOYSA-N

SMILES: O=S1(=O)C2=C(C(C)=C(C(NN)=O)S2)C(=O)NN1

Synonyms:

• 2H-Thieno[3,2-e]-1,2,3-thiadiazine-6-carboxylic acid, 3,4-dihydro-5-methyl-4-oxo-, hydrazide, 1,1-dioxide