CAS 731776-65-1: 5-[(2-Methoxyethyl)amino]-1,3,4-thiadiazole-2(3H)-thione

Description: 5-[(2-Methoxyethyl)amino]-1,3,4-thiadiazole-2(3H)-thione is a chemical compound characterized by its unique structure, which includes a thiadiazole ring and a thione functional group. This compound features a methoxyethyl amino substituent, contributing to its potential solubility and reactivity. Thiadiazoles are known for their diverse biological activities, including antimicrobial and antifungal properties, making this compound of interest in pharmaceutical research. The presence of the thione group (a sulfur atom double-bonded to a carbon atom) enhances its chemical reactivity, potentially allowing for various chemical transformations. Additionally, the methoxyethyl group may influence the compound's lipophilicity and ability to penetrate biological membranes. The compound's molecular interactions and stability can be affected by environmental factors such as pH and temperature. Overall, 5-[(2-Methoxyethyl)amino]-1,3,4-thiadiazole-2(3H)-thione represents a class of compounds that may have significant applications in medicinal chemistry and drug development.

Formula: C₅H₉N₃OS₂

InChI: InChI=1S/C5H9N3OS2/c1-9-3-2-6-4-7-8-5(10)11-4/h2-3H2,1H3,(H,6,7)(H,8,10)

InChI key: InChIKey=MXOCUHKPVMNCJR-UHFFFAOYSA-N

SMILES: S=C1SC(=NN1)NCCOC

Synonyms:

• 5-(2-Methoxyethylamino)-1,3,4-thiadiazole-2-thiol
• 5-[(2-Methoxyethyl)amino]-1,3,4-thiadiazole-2(3H)-thione
• 1,3,4-Thiadiazole-2(3H)-thione, 5-[(2-methoxyethyl)amino]-

5-[(2-Methoxyethyl)amino]-1,3,4-thiadiazole-2-thiol

CAS: 731776-65-1

Versatile small molecule scaffold

• Formula: C₅H₉N₃OS₂
• Purity: Min. 95%
• Molecular weight: 191.3 g/mol