CymitQuimica logo

CAS 731776-66-2

:

4-(2-Furanylmethyl)-2,4-dihydro-5-[3-(4-morpholinylsulfonyl)phenyl]-3H-1,2,4-triazole-3-thione

Description:
4-(2-Furanylmethyl)-2,4-dihydro-5-[3-(4-morpholinylsulfonyl)phenyl]-3H-1,2,4-triazole-3-thione is a chemical compound characterized by its complex structure, which includes a triazole ring, a furan moiety, and a morpholine sulfonyl group. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity, including antimicrobial or antifungal effects, due to the presence of the triazole and thione functional groups. The morpholine sulfonyl group may enhance solubility and bioavailability, making it of interest in pharmaceutical applications. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Its stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. As with many synthetic organic compounds, safety and handling precautions are essential, particularly in laboratory settings, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and potential applications in medicinal chemistry or other fields.
Formula:C17H18N4O4S2
InChI:InChI=1S/C17H18N4O4S2/c22-27(23,20-6-9-24-10-7-20)15-5-1-3-13(11-15)16-18-19-17(26)21(16)12-14-4-2-8-25-14/h1-5,8,11H,6-7,9-10,12H2,(H,19,26)
InChI key:InChIKey=PZPNBQYVQVKWDN-UHFFFAOYSA-N
SMILES:C(N1C(=NNC1=S)C2=CC(S(=O)(=O)N3CCOCC3)=CC=C2)C4=CC=CO4
Synonyms:
  • 3H-1,2,4-Triazole-3-thione, 4-(2-furanylmethyl)-2,4-dihydro-5-[3-(4-morpholinylsulfonyl)phenyl]-
  • Morpholine, 4-[[3-[4-(2-furanylmethyl)-4,5-dihydro-5-thioxo-1H-1,2,4-triazol-3-yl]phenyl]sulfonyl]-
  • 4-(2-Furanylmethyl)-2,4-dihydro-5-[3-(4-morpholinylsulfonyl)phenyl]-3H-1,2,4-triazole-3-thione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.