CAS 731815-66-0

N-[(3-Fluorophenyl)sulfonyl]glycine

Description:

N-[(3-Fluorophenyl)sulfonyl]glycine, with the CAS number 731815-66-0, is a chemical compound characterized by its sulfonamide functional group and an amino acid structure. It features a glycine backbone, which is the simplest amino acid, and is substituted with a 3-fluorophenyl group attached to a sulfonyl moiety. This compound exhibits properties typical of sulfonamides, including potential antibacterial activity, although its specific biological activity may vary. The presence of the fluorine atom can influence the compound's lipophilicity and reactivity, potentially enhancing its pharmacological properties. N-[(3-Fluorophenyl)sulfonyl]glycine may be of interest in medicinal chemistry for its potential applications in drug development, particularly in targeting specific biological pathways. Its solubility, stability, and reactivity are influenced by the functional groups present, making it a subject of study in various chemical and pharmaceutical research contexts. As with many sulfonamides, it may also exhibit interactions with biological systems that could be relevant for therapeutic applications.

Formula: C₈H₈FNO₄S

InChI: InChI=1S/C8H8FNO4S/c9-6-2-1-3-7(4-6)15(13,14)10-5-8(11)12/h1-4,10H,5H2,(H,11,12)

InChI key: InChIKey=LNAOZODYXFPHOX-UHFFFAOYSA-N

SMILES: S(NCC(O)=O)(=O)(=O)C1=CC(F)=CC=C1

Synonyms:

• Glycine, N-[(3-fluorophenyl)sulfonyl]-
• N-[(3-Fluorophenyl)sulfonyl]glycine

{[(3-fluorophenyl)sulfonyl]amino}acetic acid

CAS: 731815-66-0

Formula: C₈H₈FNO₄S

Purity: 95.0%

Molecular weight: 233.21

Ref: 10-F345896