CAS 731820-86-3

3-(4-Fluorophenyl)-3-(4-morpholinyl)-2-propenenitrile

Description:

3-(4-Fluorophenyl)-3-(4-morpholinyl)-2-propenenitrile, with the CAS number 731820-86-3, is an organic compound characterized by its unique structure, which includes a propenenitrile moiety substituted with both a fluorophenyl group and a morpholine ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and biological activity. The presence of the fluorine atom can enhance lipophilicity and influence the compound's interaction with biological targets. Morpholine, a cyclic amine, adds to the compound's basicity and may facilitate interactions with various receptors or enzymes. The nitrile functional group is known for its ability to participate in nucleophilic reactions and can serve as a versatile building block in synthetic chemistry. Overall, this compound may be of interest in medicinal chemistry and drug development due to its structural features, which could impart specific pharmacological properties. However, detailed studies would be necessary to fully elucidate its behavior and applications in various chemical contexts.

Formula: C₁₃H₁₃FN₂O

InChI: InChI=1S/C13H13FN2O/c14-12-3-1-11(2-4-12)13(5-6-15)16-7-9-17-10-8-16/h1-5H,7-10H2

InChI key: InChIKey=VWTCVFMZIMIAOK-UHFFFAOYSA-N

SMILES: C(=CC#N)(C1=CC=C(F)C=C1)N2CCOCC2

Synonyms:

• 2-Propenenitrile, 3-(4-fluorophenyl)-3-(4-morpholinyl)-
• 3-(4-Fluorophenyl)-3-(4-morpholinyl)-2-propenenitrile