CymitQuimica logo

CAS 731826-97-4

:

3-[1-(4-Bromophenyl)-2-nitroethyl]-1H-indole

Description:
3-[1-(4-Bromophenyl)-2-nitroethyl]-1H-indole is a chemical compound characterized by its complex structure, which includes an indole moiety and a nitroethyl group substituted with a bromophenyl group. The presence of the indole ring suggests potential biological activity, as indoles are often found in various natural products and pharmaceuticals. The bromophenyl group introduces both steric and electronic effects, which can influence the compound's reactivity and interactions with biological targets. The nitro group is known for its electron-withdrawing properties, which can affect the compound's overall polarity and solubility in different solvents. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Additionally, its unique structural features could allow for specific interactions with enzymes or receptors, potentially leading to therapeutic applications. However, detailed studies would be necessary to fully understand its behavior, including its stability, reactivity, and biological effects.
Formula:C16H13BrN2O2
InChI:InChI=1S/C16H13BrN2O2/c17-12-7-5-11(6-8-12)15(10-19(20)21)14-9-18-16-4-2-1-3-13(14)16/h1-9,15,18H,10H2
InChI key:InChIKey=WBEZFUUESLEDAL-UHFFFAOYSA-N
SMILES:C(CN(=O)=O)(C=1C=2C(NC1)=CC=CC2)C3=CC=C(Br)C=C3
Synonyms:
  • 3-[1-(4-Bromophenyl)-2-nitroethyl]-1H-indole
  • 1H-Indole, 3-[1-(4-bromophenyl)-2-nitroethyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.