CymitQuimica logo

CAS 731827-01-3

:

3-Cyclopentyl-1,2,3,5,6,7-hexahydro-2-thioxo-4H-cyclopenta[4,5]thieno[2,3-d]pyrimidin-4-one

Description:
3-Cyclopentyl-1,2,3,5,6,7-hexahydro-2-thioxo-4H-cyclopenta[4,5]thieno[2,3-d]pyrimidin-4-one is a heterocyclic compound characterized by its complex structure, which includes a fused cyclopentane and thieno-pyrimidine framework. This compound features a cyclopentyl substituent, contributing to its unique properties and potential biological activity. The presence of a thioxo group indicates that it may exhibit reactivity typical of thioketones, potentially influencing its interactions in biological systems. The hexahydro configuration suggests that the compound is saturated, which may affect its solubility and stability. Such compounds are often investigated for their pharmacological properties, including potential applications in medicinal chemistry. The specific arrangement of atoms and functional groups in this molecule can lead to diverse interactions with biological targets, making it a subject of interest in drug discovery and development. Overall, the characteristics of this compound highlight its potential utility in various chemical and pharmaceutical applications.
Formula:C14H16N2OS2
InChI:InChI=1S/C14H16N2OS2/c17-13-11-9-6-3-7-10(9)19-12(11)15-14(18)16(13)8-4-1-2-5-8/h8H,1-7H2,(H,15,18)
InChI key:InChIKey=ODFQUDWKTRJFQT-UHFFFAOYSA-N
SMILES:O=C1C=2C3=C(SC2NC(=S)N1C4CCCC4)CCC3
Synonyms:
  • 3-Cyclopentyl-1,2,3,5,6,7-hexahydro-2-thioxo-4H-cyclopenta[4,5]thieno[2,3-d]pyrimidin-4-one
  • 4H-Cyclopenta[4,5]thieno[2,3-d]pyrimidin-4-one, 3-cyclopentyl-1,2,3,5,6,7-hexahydro-2-thioxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.