
CAS 731827-08-0
:2,3-Dihydro-5,6-dimethyl-3-(2-methylphenyl)-2-thioxothieno[2,3-d]pyrimidin-4(1H)-one
Description:
2,3-Dihydro-5,6-dimethyl-3-(2-methylphenyl)-2-thioxothieno[2,3-d]pyrimidin-4(1H)-one is a heterocyclic compound characterized by its complex structure, which includes a thieno[2,3-d]pyrimidine core. This compound features a thioxo group, contributing to its reactivity and potential biological activity. The presence of multiple methyl groups enhances its lipophilicity, which may influence its solubility and permeability in biological systems. The compound's unique arrangement of substituents, including a 2-methylphenyl group, suggests potential interactions with various biological targets, making it of interest in medicinal chemistry. Its molecular structure may confer specific pharmacological properties, although detailed studies would be necessary to elucidate its mechanism of action and therapeutic potential. Additionally, the compound's CAS number, 731827-08-0, allows for easy identification and reference in chemical databases, facilitating research and development efforts. Overall, this compound represents a class of thienopyrimidines that may have applications in drug discovery and development.
Formula:C15H14N2OS2
InChI:InChI=1S/C15H14N2OS2/c1-8-6-4-5-7-11(8)17-14(18)12-9(2)10(3)20-13(12)16-15(17)19/h4-7H,1-3H3,(H,16,19)
InChI key:InChIKey=OURXSXYGJAAVQB-UHFFFAOYSA-N
SMILES:O=C1C2=C(NC(=S)N1C3=C(C)C=CC=C3)SC(C)=C2C
Synonyms:- Thieno[2,3-d]pyrimidin-4(1H)-one, 2,3-dihydro-5,6-dimethyl-3-(2-methylphenyl)-2-thioxo-
- 2,3-Dihydro-5,6-dimethyl-3-(2-methylphenyl)-2-thioxothieno[2,3-d]pyrimidin-4(1H)-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.