CAS 732-50-3

Baptifoline

Description:

Baptifoline, with the CAS number 732-50-3, is a naturally occurring alkaloid primarily derived from certain plant species, particularly those in the family of Apocynaceae. This compound is characterized by its complex molecular structure, which includes multiple rings and functional groups that contribute to its biological activity. Baptifoline exhibits a range of pharmacological properties, including potential anti-inflammatory and analgesic effects, making it of interest in medicinal chemistry and pharmacology. Its solubility characteristics can vary, often being more soluble in organic solvents than in water, which is typical for many alkaloids. The compound's stability can be influenced by environmental factors such as pH and temperature. Research into Baptifoline's mechanisms of action and therapeutic potential is ongoing, as scientists explore its efficacy and safety for various applications. Overall, Baptifoline represents a fascinating subject of study within the realm of natural products and their potential benefits in health and medicine.

Formula: C₁₅H₂₀N₂O₂

InChI: InChI=1S/C15H20N2O2/c18-12-4-5-16-8-10-6-11(14(16)7-12)9-17-13(10)2-1-3-15(17)19/h1-3,10-12,14,18H,4-9H2/t10-,11-,12-,14-/m1/s1

InChI key: InChIKey=AOOCSKCGZYCEJX-HKUMRIAESA-N

SMILES: O[C@H]1C[C@@]2([C@@]3(C[C@](CN2CC1)(C=4N(C3)C(=O)C=CC4)[H])[H])[H]

Synonyms:

• Baptifoline, (-)-
• 7,14-Methano-2H,11H-dipyrido[1,2-a:1′,2′-e][1,5]diazocin-11-one, 1,3,4,6,7,13,14,14a-octahydro-2-hydroxy-, (2R,7R,14R,14aR)-
• 7,14-Methano-2H,11H-dipyrido[1,2-a:1′,2′-e][1,5]diazocin-11-one, 1,3,4,6,7,13,14,14a-octahydro-2-hydroxy-, [2R-(2α,7α,14α,14aβ)]-
• Baptifoline
• (2R,7R,14R,14aR)-1,3,4,6,7,13,14,14a-Octahydro-2-hydroxy-7,14-methano-2H,11H-dipyrido[1,2-a:1′,2′-e][1,5]diazocin-11-one

Baptifoline

CAS: 732-50-3

Baptifoline

Purity: ≥98%

Molecular weight: 260.33g/mol

Ref: 54-BUP21964

Baptifoline

CAS: 732-50-3

Baptifoline is an alkaloid isolated from Anagyris foetida with potential antibacterial activity.

Formula: C₁₅H₂₀N₂O₂

Purity: 99.00%

Color and Shape: Solid

Molecular weight: 260.33

Ref: TM-TN3488

Baptifoline

CAS: 732-50-3

Baptifoline is an indole alkaloid, which is a naturally occurring compound derived primarily from the plant *Baptisia australis*, commonly known as blue wild indigo. As an alkaloid, it belongs to a class of compounds typically characterized by complex nitrogen-containing structures, often associated with bioactive properties.

Formula: C₁₅H₂₀N₂O₂

Purity: Min. 95%

Molecular weight: 260.33 g/mol

Ref: 3D-XB175860