CAS 732-80-9

Ethyl 4'-methoxy-4-biphenylcarboxylate

Description:

Ethyl 4'-methoxy-4-biphenylcarboxylate, with the CAS number 732-80-9, is an organic compound characterized by its biphenyl structure substituted with a methoxy group and an ethyl ester functional group. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its moderate solubility in organic solvents such as ethanol and ether, while being less soluble in water due to its hydrophobic biphenyl backbone. Ethyl 4'-methoxy-4-biphenylcarboxylate is often utilized in organic synthesis and may serve as an intermediate in the production of various pharmaceuticals and agrochemicals. Its chemical properties include the ability to undergo typical reactions of esters, such as hydrolysis and transesterification. Additionally, the presence of the methoxy group can influence its reactivity and interaction with other chemical species, making it a valuable compound in synthetic organic chemistry. Safety precautions should be observed when handling this compound, as with many organic chemicals, to minimize exposure and ensure safe laboratory practices.

Formula: C₁₆H₁₆O₃

InChI: InChI=1/C16H16O3/c1-3-19-16(17)14-6-4-12(5-7-14)13-8-10-15(18-2)11-9-13/h4-11H,3H2,1-2H3

SMILES: CCOC(=O)c1ccc(cc1)c1ccc(cc1)OC

Synonyms:

• Ethyl 4'-Methoxybiphenyl-4-Carboxylate

Ethyl 4'-methoxy-[1,1'-biphenyl]-4-carboxylate

CAS: 732-80-9

Formula: C₁₆H₁₆O₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 256.2964

Ref: IN-DA003QB7

Ethyl 4'-methoxy-[1,1'-biphenyl]-4-carboxylate

CAS: 732-80-9

Ethyl 4'-methoxy-[1,1'-biphenyl]-4-carboxylate

Formula: C₁₆H₁₆O₃

Purity: 99%

Color and Shape: Solid

Molecular weight: 256.30g/mol

Ref: 54-OR14376

ethyl 4′-methoxybiphenyl-4-carboxylate

CAS: 732-80-9

Formula: C₁₆H₁₆O₃

Purity: 98%

Molecular weight: 256.301

Ref: 10-F200789