CAS 73200-73-4
:3-phenylpyrazin-2(1H)-one
Description:
3-Phenylpyrazin-2(1H)-one, identified by its CAS number 73200-73-4, is a heterocyclic organic compound featuring a pyrazinone structure with a phenyl group attached. This compound typically exhibits a fused bicyclic system, characterized by a pyrazine ring and a carbonyl group, which contributes to its reactivity and potential biological activity. It is generally soluble in organic solvents, reflecting its non-polar characteristics due to the presence of the phenyl group. The compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its structure allows for potential interactions with biological targets, and it may participate in various chemical reactions, including nucleophilic substitutions and cycloadditions. The presence of the pyrazinone moiety can also influence its acidity and basicity, affecting its behavior in different chemical environments. Overall, 3-phenylpyrazin-2(1H)-one is a compound of interest for further research in both synthetic and medicinal chemistry contexts.
Formula:C10H8N2O
InChI:InChI=1/C10H8N2O/c13-10-9(11-6-7-12-10)8-4-2-1-3-5-8/h1-7H,(H,12,13)
SMILES:c1ccc(cc1)c1c(=O)[nH]ccn1
Synonyms:- 2(1H)-Pyrazinone, 3-phenyl-
- 2-Pyrazinol, 3-Phenyl-
- 3-Phenylpyrazin-2-ol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 9 products.
3-Phenylpyrazin-2-ol (3-Phenylpyrazin-2-ol)
CAS:Heterocyclic compounds with nitrogen hetero-atom(s) only, aromatic or modified aromatic, nesoiFormula:C10H8N2OColor and Shape:Light Yellow SolidMolecular weight:172.06366Ampicillin EP Impurity H (Cefaclor EP Impurity F)
CAS:Formula:C10H8N2OColor and Shape:Pale Yellow SolidMolecular weight:172.193-Phenylpyrazin-2-ol
CAS:Controlled ProductFormula:C10H8N2OColor and Shape:NeatMolecular weight:172.183-Phenylpyrazin-2-ol
CAS:Controlled Product<p>Applications 3-Phenylpyrazin-2-ol has 2-Hydroxypyrazine(H952710), in its structure. 2-Hydroxypyrazine also used in the synthesis of potential antioxidants. Is also used in the preparation of antibacterial agents as 2-substituted pyrazine derivatives.<br>References Shi, J. et al.: J. Phys. Org. Chem., 22, 1038 (2009); Bonde, C. et al.: Ind. J. Hetero. Chem., 10, 271 (2001);<br></p>Formula:C10H8N2OColor and Shape:NeatMolecular weight:172.183-Phenylpyrazin-2-ol
CAS:3-Phenylpyrazin-2-ol is a useful organic compound for research related to life sciences. The catalog number is T66288 and the CAS number is 73200-73-4.Formula:C10H8N2OColor and Shape:SolidMolecular weight:172.187
