CAS 73204-06-5

4-(4-Oxocyclohexyl)benzamide

Description:

4-(4-Oxocyclohexyl)benzamide, identified by its CAS number 73204-06-5, is an organic compound characterized by its structural features, which include a benzamide moiety and a cyclohexyl group with a ketone functional group. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the amide functional group suggests that it may engage in hydrogen bonding, influencing its physical properties such as melting point and solubility in polar solvents. Additionally, the ketone group can participate in various chemical reactions, including nucleophilic additions and reductions. The compound may also exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its stability and reactivity can be influenced by the steric and electronic effects of the substituents on the aromatic ring and the cyclohexyl group. Overall, 4-(4-Oxocyclohexyl)benzamide represents a versatile structure with potential applications in various chemical and pharmaceutical contexts.

Formula: C₁₃H₁₅NO₂

InChI: InChI=1S/C13H15NO2/c14-13(16)11-3-1-9(2-4-11)10-5-7-12(15)8-6-10/h1-4,10H,5-8H2,(H2,14,16)

InChI key: InChIKey=QWCRAYDIXLUPOT-UHFFFAOYSA-N

SMILES: C(N)(=O)C1=CC=C(C=C1)C2CCC(=O)CC2

Synonyms:

• 4-(4-Oxocyclohexyl)benzamide
• Benzamide, 4-(4-oxocyclohexyl)-
• N-(4-Oxocyclohexyl)benzamide
• benzamide, N-(4-oxocyclohexyl)-