CAS 73208-61-4
:[(3S,4R,5S,6S)-5-acetamido-4,6-diacetoxy-3-[(2S,3S,4S,5S)-3,4,5-triacetoxy-6-(acetoxymethyl)tetrahydropyran-2-yl]oxy-tetrahydropyran-2-yl]methyl acetate
Description:
The chemical substance with the name "[(3S,4R,5S,6S)-5-acetamido-4,6-diacetoxy-3-[(2S,3S,4S,5S)-3,4,5-triacetoxy-6-(acetoxymethyl)tetrahydropyran-2-yl]oxy-tetrahydropyran-2-yl]methyl acetate" and CAS number 73208-61-4 is a complex organic compound characterized by multiple functional groups, including acetamido and acetoxy moieties. It features a tetrahydropyran backbone, which is a six-membered cyclic ether, contributing to its stereochemistry and potential biological activity. The presence of multiple acetoxy groups suggests that the compound may have applications in medicinal chemistry, possibly as a prodrug or in the synthesis of other bioactive molecules. Its stereochemical configuration, indicated by the specific (S) and (R) designations, is crucial for its interaction with biological targets, influencing its pharmacokinetics and pharmacodynamics. The compound's solubility, stability, and reactivity are likely influenced by its functional groups and stereochemistry, making it a subject of interest in both synthetic and medicinal chemistry research.
Formula:C28H39NO18
InChI:InChI=1/C28H39NO18/c1-11(30)29-21-24(41-15(5)34)22(19(9-38-12(2)31)45-27(21)44-18(8)37)47-28-26(43-17(7)36)25(42-16(6)35)23(40-14(4)33)20(46-28)10-39-13(3)32/h19-28H,9-10H2,1-8H3,(H,29,30)/t19?,20?,21-,22+,23-,24+,25-,26-,27+,28-/m0/s1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N-Acetyllactosamine heptaacetate
CAS:N-Acetyllactosamine heptaacetatePurity:98%Color and Shape:Beige SolidMolecular weight:677.61g/molN-Acetyl-D-lactosamine heptaacetate
CAS:N-Acetyl-D-lactosamine heptaacetate is a synthetically produced, fluorinated monosaccharide that is used in the production of glycosylations and polysaccharides. N-Acetyl-D-lactosamine heptaacetate can be custom synthesized to meet your needs. This compound is a high purity product.
Formula:C28H39NO18Purity:Min. 95%Color and Shape:PowderMolecular weight:677.61 g/molN-Acetyllactosamine Heptaacetate
CAS:Controlled ProductApplications Intermediate in the preparation of glycoclusters
References Gao, Y., et al.: Bioorg. Med. Chem., 13, 6151 (2005),Formula:C28H39NO18Color and Shape:NeatMolecular weight:677.61



