CAS 73208-80-7
:methyl (2R,4R,5R)-5-acetamido-4-acetoxy-2-methoxy-6-[(1S,2R)-1,2,3-triacetoxypropyl]tetrahydropyran-2-carboxylate
Description:
Methyl (2R,4R,5R)-5-acetamido-4-acetoxy-2-methoxy-6-[(1S,2R)-1,2,3-triacetoxypropyl]tetrahydropyran-2-carboxylate is a complex organic compound characterized by its intricate structure, which includes multiple functional groups such as acetamido, acetoxy, and methoxy moieties. This compound features a tetrahydropyran ring, a six-membered cyclic ether, which contributes to its stability and reactivity. The presence of various acetyl groups suggests potential applications in medicinal chemistry, particularly in drug design, due to their ability to modify biological activity. The stereochemistry indicated by the (R) and (S) designations suggests specific spatial arrangements of atoms, which can significantly influence the compound's interactions with biological targets. Additionally, the methyl ester functional group enhances its solubility in organic solvents, making it suitable for various synthetic applications. Overall, this compound exemplifies the complexity and diversity of organic molecules, with potential implications in pharmacology and organic synthesis.
Formula:C21H31NO13
InChI:InChI=1/C21H31NO13/c1-10(23)22-17-15(32-12(3)25)8-21(30-7,20(28)29-6)35-19(17)18(34-14(5)27)16(33-13(4)26)9-31-11(2)24/h15-19H,8-9H2,1-7H3,(H,22,23)/t15-,16-,17-,18-,19?,21-/m1/s1
SMILES:CC(=N[C@@H]1[C@@H](C[C@@](C(=O)OC)(OC)OC1[C@@H]([C@@H](COC(=O)C)OC(=O)C)OC(=O)C)OC(=O)C)O
Synonyms:- methyl [methyl 4,7,8,9-tetra-O-acetyl-5-acetamido-3,5-dideoxy-α-D-glycero-D-galacto-non-2-ulopyranoside]onate
- N-Acetyl-2-O-methyl-a-neuraminic Acid Methyl Ester 4,7,8,9-Tetraacetate
- α-Neuraminic acid, N-acetyl-2-O-methyl-, methyl ester, 4,7,8,9-tetraacetate
- Methyl(Methyl-5-acetaMido-4,7,8,9-tetra-D-acetyl-3,5-dideoxy-D-glycero-α-D-galacto-2-nonulopyranoside)onate
- N-Acetyl-2-O-methyl-α-neuraminic Acid Methyl Ester 4,7,8,9-Tetraacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
N-Acetyl-2-O-methyl-a-neuraminic Acid Methyl Ester 4,7,8,9-T
CAS:Controlled ProductApplications Intermediate for the synthesis of supressor T cell inducers.
References Kijima, I., et al.: Chem. Pharm. Bull., 30, 3278 (1982), Knibbs, R.N., et al.: J. Biol. Chem., 268, 18524 (1993),Formula:C21H31NO13Color and Shape:NeatMolecular weight:505.47N-Acetyl-2-O-methyl-a-neuraminic acid methyl ester 4,7,8,9-tetraacetate
CAS:N-Acetyl-2-O-methyl-a-neuraminic acid methyl ester 4,7,8,9-tetraacetate is a synthetic monosaccharide that is the methyl ester of 2-O-Methyl alpha-neuraminic acid. It is an important reagent in the synthesis of oligosaccharides and polysaccharides. Methylation of the hydroxyl group on the C4' atom of NAMNAA (4,7,8,9 tetraacetate) with methyl iodide followed by acetylation with acetic anhydride produces the desired product. The resulting product has a purity level of >98% and CAS No. 73208-80-7.Formula:C21H31NO13Purity:Min. 95%Molecular weight:505.47 g/mol


