CAS 7321-94-0

1,3-Dihydro-1-methyl-2H-imidazo[4,5-c]pyridine-2-thione

Description:

1,3-Dihydro-1-methyl-2H-imidazo[4,5-c]pyridine-2-thione, with CAS number 7321-94-0, is a heterocyclic compound featuring a fused imidazole and pyridine ring system. This compound is characterized by the presence of a thione functional group, which is a sulfur-containing analogue of a ketone. It typically exhibits a pale yellow to brownish color and is soluble in organic solvents. The molecular structure contributes to its potential biological activity, making it of interest in medicinal chemistry. The thione group can participate in various chemical reactions, including nucleophilic attacks, which may enhance its reactivity and utility in synthetic applications. Additionally, compounds of this class may exhibit pharmacological properties, including antimicrobial or anti-inflammatory activities, although specific biological data may vary. As with many heterocycles, the stability and reactivity of this compound can be influenced by substituents on the ring, making it a versatile scaffold for further chemical modifications. Proper handling and safety precautions are essential due to potential toxicity associated with sulfur-containing compounds.

Formula: C₇H₇N₃S

InChI: InChI=1S/C7H7N3S/c1-10-6-2-3-8-4-5(6)9-7(10)11/h2-4H,1H3,(H,9,11)

InChI key: InChIKey=GCYONDMJGUUSSV-UHFFFAOYSA-N

SMILES: CN1C=2C(NC1=S)=CN=CC2

Synonyms:

• 1-Methyl-1H-imidazo[4,5-c]pyridine-2(3H)-thione
• 1,3-Dihydro-1-methyl-2H-imidazo[4,5-c]pyridine-2-thione
• 1H-Imidazo[4,5-c]pyridine-2-thiol, 1-methyl-
• 1-Methyl-2-mercaptoimidazolo[4,5-c]pyridine
• 2H-Imidazo[4,5-c]pyridine-2-thione, 1,3-dihydro-1-methyl-

1-Methyl-1H-imidazo[4,5-c]pyridine-2-thiol

CAS: 7321-94-0

Versatile small molecule scaffold

Formula: C₇H₇N₃S

Purity: Min. 95%

Molecular weight: 165.22 g/mol

Ref: 3D-HAA32194