
CAS 7321-95-1
:1-Methyl-2-(methylthio)-1H-imidazo[4,5-c]pyridine
Description:
1-Methyl-2-(methylthio)-1H-imidazo[4,5-c]pyridine, with the CAS number 7321-95-1, is a heterocyclic organic compound characterized by its imidazo[4,5-c]pyridine structure, which incorporates both nitrogen and sulfur atoms in its ring system. This compound typically exhibits a pale yellow to brownish color and is soluble in organic solvents, reflecting its non-polar characteristics. It is known for its potential biological activity, particularly in the field of medicinal chemistry, where it may serve as a scaffold for the development of pharmaceuticals. The presence of the methylthio group enhances its reactivity and may influence its interaction with biological targets. Additionally, this compound may exhibit properties such as fluorescence or photostability, making it of interest in various applications, including agrochemicals and materials science. Safety data should be consulted for handling and exposure guidelines, as with any chemical substance, to ensure proper laboratory practices.
Formula:C8H9N3S
InChI:InChI=1S/C8H9N3S/c1-11-7-3-4-9-5-6(7)10-8(11)12-2/h3-5H,1-2H3
InChI key:InChIKey=UIFMVOCSENMRMF-UHFFFAOYSA-N
SMILES:CN1C=2C(N=C1SC)=CN=CC2
Synonyms:- 1H-Imidazo[4,5-c]pyridine, 1-methyl-2-(methylthio)-
- 1-Methyl-2-(methylsulfanyl)-1H-imidazo[4,5-c]pyridine
- 1-Methyl-2-(methylthio)-1H-imidazo[4,5-c]pyridine
- 1-Methyl-2-methylsulfanylimidazo[4,5-c]pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.