CAS 73210-82-9

4,5,10-trihydroxy-7-methyl-1,1-bis(3-methylbut-2-en-1-yl)anthracen-2(1H)-one

Description:

4,5,10-trihydroxy-7-methyl-1,1-bis(3-methylbut-2-en-1-yl)anthracen-2(1H)-one, with CAS number 73210-82-9, is a complex organic compound belonging to the anthraquinone class. This substance features multiple hydroxyl groups, which contribute to its solubility and reactivity, particularly in biological systems. The presence of the anthracene core provides a stable aromatic structure, while the bis(3-methylbut-2-en-1-yl) substituents introduce additional reactivity and potential for various chemical interactions. The hydroxyl groups can participate in hydrogen bonding, influencing the compound's physical properties such as melting point and solubility in polar solvents. This compound may exhibit biological activity, making it of interest in fields such as medicinal chemistry and natural product research. Its structural complexity suggests potential applications in organic synthesis and material science, although specific applications would depend on further research into its properties and behavior in different environments. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical behavior.

Formula: C₂₅H₂₈O₄

InChI: InChI=1/C25H28O4/c1-14(2)6-8-25(9-7-15(3)4)18-12-17-10-16(5)11-19(26)22(17)24(29)23(18)20(27)13-21(25)28/h6-7,10-13,26-27,29H,8-9H2,1-5H3

SMILES: CC(=CCC1(CC=C(C)C)c2cc3cc(C)cc(c3c(c2C(=CC1=O)O)O)O)C

Vismin

CAS: 73210-82-9

Please enquire for more information about Vismin including the price, delivery time and more detailed product information at the technical inquiry form on this page

Formula: C₂₅H₂₈O₄

Purity: Min. 95%

Molecular weight: 392.49 g/mol

Ref: 3D-XV166732