CymitQuimica logo

CAS 73212-55-2

:

2,2-dichloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide

Description:
2,2-Dichloro-N-[(1R,2S)-3-fluoro-1-hydroxy-1-(4-nitrophenyl)propan-2-yl]acetamide, with the CAS number 73212-55-2, is a chemical compound characterized by its complex structure, which includes dichloro and nitrophenyl functional groups. This compound features a chiral center, indicated by the (1R,2S) configuration, which contributes to its potential biological activity and specificity in interactions. The presence of a fluorine atom and a hydroxyl group suggests that it may exhibit unique reactivity and solubility properties. Typically, compounds of this nature are investigated for their potential applications in pharmaceuticals, particularly as intermediates or active ingredients in drug development. The dichloroacetamide moiety may also impart certain stability and reactivity characteristics, influencing its behavior in various chemical environments. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, would depend on the specific conditions and purity of the sample. Safety and handling precautions are essential due to the presence of halogenated and nitro groups, which can pose health and environmental risks.
Formula:C11H11Cl2FN2O4
InChI:InChI=1/C11H11Cl2FN2O4/c12-10(13)11(18)15-8(5-14)9(17)6-1-3-7(4-2-6)16(19)20/h1-4,8-10,17H,5H2,(H,15,18)/t8-,9-/m1/s1
SMILES:c1cc(ccc1[C@H]([C@@H](CF)N=C(C(Cl)Cl)O)O)N(=O)=O
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.