CAS 73214-24-1
:3-Chloro-6-phenyl-1,2,4-triazine
Description:
3-Chloro-6-phenyl-1,2,4-triazine is a heterocyclic organic compound characterized by its triazine ring structure, which consists of three nitrogen atoms and three carbon atoms. The presence of a chlorine atom at the 3-position and a phenyl group at the 6-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. It is known for its potential applications in agrochemicals, particularly as a herbicide or fungicide, due to its ability to inhibit specific biochemical pathways in plants. Additionally, 3-chloro-6-phenyl-1,2,4-triazine may also serve as an intermediate in the synthesis of other chemical compounds. Its reactivity can be influenced by the electron-withdrawing nature of the chlorine atom and the electron-donating characteristics of the phenyl group, making it a versatile building block in organic synthesis. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C9H6ClN3
InChI:InChI=1/C9H6ClN3/c10-9-11-6-8(12-13-9)7-4-2-1-3-5-7/h1-6H
SMILES:c1ccc(cc1)c1cnc(Cl)nn1
Synonyms:- 1,2,4-Triazine, 3-Chloro-6-Phenyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.