CAS 73217-34-2

3-(Chloromethyl)-5-(2-methylphenyl)-1,2,4-oxadiazole

Description:

3-(Chloromethyl)-5-(2-methylphenyl)-1,2,4-oxadiazole is a heterocyclic organic compound characterized by the presence of an oxadiazole ring, which consists of two nitrogen atoms and three carbon atoms in a five-membered ring. This compound features a chloromethyl group and a 2-methylphenyl substituent, contributing to its unique chemical properties. The chloromethyl group can participate in nucleophilic substitution reactions, making the compound potentially reactive. The presence of the aromatic 2-methylphenyl group enhances its lipophilicity and may influence its biological activity. This compound is typically used in research and development, particularly in the fields of medicinal chemistry and materials science, due to its potential applications in drug design and synthesis. Its molecular structure suggests it may exhibit interesting electronic properties, which could be explored for various applications, including as a building block in organic synthesis or as a precursor for more complex molecules. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₁₀H₉ClN₂O

InChI: InChI=1S/C10H9ClN2O/c1-7-4-2-3-5-8(7)10-12-9(6-11)13-14-10/h2-5H,6H2,1H3

InChI key: InChIKey=IHFBPVISJMSYSI-UHFFFAOYSA-N

SMILES: CC1=C(C2=NC(CCl)=NO2)C=CC=C1

Synonyms:

• 3-Chloromethyl-5-o-tolyl-[1,2,4]oxadiazole
• 1,2,4-Oxadiazole, 3-(chloromethyl)-5-(2-methylphenyl)-
• 3-(Chloromethyl)-5-(2-methylphenyl)-1,2,4-oxadiazole

3-(Chloromethyl)-5-(2-methylphenyl)-1,2,4-oxadiazole

CAS: 73217-34-2

Versatile small molecule scaffold

Formula: C₁₀H₉ClN₂O

Purity: Min. 95%

Molecular weight: 208.64 g/mol

Ref: 3D-YCA21734