CAS 73217-78-4

3-(4-Nitrophenyl)-1,2,4-oxadiazole-5-carboxaldehyde

Description:

3-(4-Nitrophenyl)-1,2,4-oxadiazole-5-carboxaldehyde is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. The presence of a nitrophenyl group at the 3-position contributes to its electron-withdrawing properties, enhancing its reactivity and potential applications in various fields, including organic synthesis and materials science. The aldehyde functional group at the 5-position allows for further chemical modifications, making it a versatile intermediate in the synthesis of more complex molecules. This compound is typically used in the development of fluorescent dyes, agrochemicals, and pharmaceuticals due to its unique electronic properties. Additionally, its stability and solubility in organic solvents make it suitable for various laboratory applications. Safety considerations should be taken into account when handling this compound, as it may pose health risks due to the presence of the nitro group, which can be toxic and potentially explosive under certain conditions.

Formula: C₉H₅N₃O₄

InChI: InChI=1S/C9H5N3O4/c13-5-8-10-9(11-16-8)6-1-3-7(4-2-6)12(14)15/h1-5H

InChI key: InChIKey=NUBDABBFPSPVHP-UHFFFAOYSA-N

SMILES: C(=O)C1=NC(=NO1)C2=CC=C(N(=O)=O)C=C2

Synonyms:

• 3-(4-Nitrophenyl)-1,2,4-oxadiazole-5-carboxaldehyde
• 1,2,4-Oxadiazole-5-carboxaldehyde, 3-(4-nitrophenyl)-