CymitQuimica logo

CAS 73219-44-0

:

methyl (3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetate

Description:
Methyl (3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetate is a chemical compound characterized by its unique structure, which includes a benzoxazine ring fused with a carbonyl group and an acetate moiety. This compound typically exhibits a molecular formula that reflects its complex structure, incorporating elements such as carbon, hydrogen, nitrogen, and oxygen. It is often recognized for its potential applications in various fields, including pharmaceuticals and agrochemicals, due to its bioactive properties. The presence of the benzoxazine ring suggests that it may participate in various chemical reactions, including cycloadditions and substitutions, making it a versatile intermediate in organic synthesis. Additionally, the compound may exhibit specific physical properties such as solubility in organic solvents and stability under certain conditions, which are important for its handling and application. As with many organic compounds, safety data should be consulted to understand its toxicity and environmental impact. Overall, methyl (3-oxo-3,4-dihydro-2H-1,4-benzoxazin-2-yl)acetate represents a significant compound in the realm of organic chemistry.
Formula:C11H11NO4
InChI:InChI=1/C11H11NO4/c1-15-10(13)6-9-11(14)12-7-4-2-3-5-8(7)16-9/h2-5,9H,6H2,1H3,(H,12,14)
SMILES:COC(=O)CC1C(=Nc2ccccc2O1)O
Synonyms:
  • 2H-1,4-benzoxazine-2-acetic acid, 3,4-dihydro-3-oxo-, methyl ester
  • 2H-1,4-benzoxazine-2-acetic acid, 3-hydroxy-, methyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.