CAS 73219-89-3

3-Bromo-2,6-dimethoxybenzoic acid

Description:

3-Bromo-2,6-dimethoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of a bromine atom and two methoxy groups on a benzene ring. The compound features a carboxylic acid functional group (-COOH) that imparts acidic properties, making it soluble in polar solvents. The bromine substituent enhances the compound's reactivity, particularly in electrophilic aromatic substitution reactions. The methoxy groups (-OCH3) are electron-donating, which can influence the compound's reactivity and stability. This compound is typically used in organic synthesis and may serve as an intermediate in the production of pharmaceuticals or agrochemicals. Its molecular structure contributes to its potential applications in various chemical reactions, including coupling reactions and as a building block for more complex molecules. Additionally, the presence of multiple functional groups allows for diverse chemical modifications, making it a versatile compound in synthetic organic chemistry. Safety data should be consulted for handling and storage, as with all chemical substances.

Formula: C₉H₉BrO₄

InChI: InChI=1/C9H9BrO4/c1-13-6-4-3-5(10)8(14-2)7(6)9(11)12/h3-4H,1-2H3,(H,11,12)

SMILES: COc1ccc(c(c1C(=O)O)OC)Br

Synonyms:

• Benzoic Acid, 3-Bromo-2,6-Dimethoxy-

3-Bromo-2,6-dimethoxybenzoic acid

CAS: 73219-89-3

Formula: C₉H₉BrO₄

Purity: 95%

Color and Shape: Solid

Molecular weight: 261.0694

Ref: IN-DA003J02

3-Bromo-2,6-dimethoxybenzoic acid

CAS: 73219-89-3

3-Bromo-2,6-dimethoxybenzoic acid

Purity: ≥95%

Molecular weight: 261.07g/mol

Ref: 54-OR21583

3-Bromo-2,6-dimethoxybenzoic acid

CAS: 73219-89-3

3-Bromo-2,6-dimethoxybenzoic acid is a synthetic chemical used to introduce insulators into the DNA molecule. It is also used as a treatment method for introducing branched-chain scripts into the DNA molecule. 3-Bromo-2,6-dimethoxybenzoic acid has been shown to counteract synthetic techniques, such as transistors, and can be used in plant physiology research.

Formula: C₉H₉BrO₄

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 261.07 g/mol

Ref: 3D-FB70564