CAS 73219-92-8

3-Bromo-5-chloro-2,6-dimethoxybenzoic acid

Description:

3-Bromo-5-chloro-2,6-dimethoxybenzoic acid is an aromatic carboxylic acid characterized by the presence of multiple halogen and methoxy substituents on a benzoic acid framework. The compound features a bromine atom at the 3-position and a chlorine atom at the 5-position of the benzene ring, along with two methoxy groups (-OCH3) located at the 2 and 6 positions. This substitution pattern contributes to its unique chemical properties, including potential reactivity in electrophilic aromatic substitution reactions and its ability to form hydrogen bonds due to the carboxylic acid functional group. The presence of halogens can also influence the compound's solubility and polarity. 3-Bromo-5-chloro-2,6-dimethoxybenzoic acid may be utilized in various applications, including organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. Its specific physical properties, such as melting point and solubility, would need to be determined experimentally, as they can vary based on purity and environmental conditions.

Formula: C₉H₈BrClO₄

InChI: InChI=1S/C9H8BrClO4/c1-14-7-4(10)3-5(11)8(15-2)6(7)9(12)13/h3H,1-2H3,(H,12,13)

InChI key: InChIKey=VOIBMJIPLSKRQL-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=C(OC)C(Br)=CC(Cl)=C1OC

Synonyms:

• Benzoic acid, 3-bromo-5-chloro-2,6-dimethoxy-
• 3-Bromo-5-chloro-2,6-dimethoxybenzoic acid

3-Bromo-5-chloro-2,6-dimethoxybenzoic acid

CAS: 73219-92-8

3-Bromo-5-chloro-2,6-dimethoxybenzoic acid

Purity: ≥95%

Molecular weight: 295.51g/mol

Ref: 54-OR111641