CAS 7322-31-8
:β-D-mannopyranose
Description:
β-D-mannopyranose is a six-membered cyclic form of the sugar mannose, which is an aldohexose. It is characterized by its pyranose ring structure, where the hydroxyl (-OH) groups are positioned in a specific orientation that defines its β-anomeric configuration. This compound is a white crystalline solid that is soluble in water, reflecting its polar nature due to multiple hydroxyl groups. β-D-mannopyranose plays a significant role in various biological processes, including serving as a building block for polysaccharides and glycoproteins. It is also involved in cell recognition and signaling pathways. The molecule exhibits specific optical activity, rotating plane-polarized light to the right due to its chiral centers. In terms of reactivity, it can participate in glycosidic bond formation, making it essential in carbohydrate chemistry. Its CAS number, 7322-31-8, is a unique identifier that facilitates its identification in chemical databases and literature. Overall, β-D-mannopyranose is an important carbohydrate with diverse applications in biochemistry and industry.
Formula:C6H12O6
InChI:InChI=1/C6H12O6/c7-1-2-3(8)4(9)5(10)6(11)12-2/h2-11H,1H2/t2-,3-,4+,5+,6-/m1/s1
InChI key:InChIKey=WQZGKKKJIJFFOK-RWOPYEJCSA-N
SMILES:C(O)[C@@H]1[C@@H](O)[C@H](O)[C@H](O)[C@H](O)O1
Synonyms:- Mannopyranose, β-<span class="text-smallcaps">D</span>-
- Mannose, β-<span class="text-smallcaps">D</span>-
- beta-D-Mannopyranose
- beta-Mannose
- β-<span class="text-smallcaps">D</span>-Mannopyranose
- β-<span class="text-smallcaps">D</span>-Mannose
- β-Mannose
- Mannopyranose, β-D-
- β-D-Mannose
- Mannose, β-D-
- β-D-Mannopyranose
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.