CAS 7322-46-5
:1,4-Dihydro-1,4-ethanonaphthalene
Description:
1,4-Dihydro-1,4-ethanonaphthalene, with the CAS number 7322-46-5, is an organic compound that belongs to the class of polycyclic aromatic hydrocarbons. It features a naphthalene structure with two hydrogen atoms added to the 1 and 4 positions, resulting in a saturated derivative. This compound is characterized by its relatively low reactivity compared to unsaturated naphthalene derivatives, primarily due to the presence of the additional hydrogen atoms that stabilize the structure. It is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. The compound is of interest in various chemical applications, including organic synthesis and as a potential intermediate in the production of more complex molecules. Its physical properties, such as boiling point and solubility, can vary based on the specific conditions and purity of the sample. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if inhaled or ingested.
Formula:C12H12
InChI:InChI=1S/C12H12/c1-2-4-12-10-7-5-9(6-8-10)11(12)3-1/h1-5,7,9-10H,6,8H2
InChI key:InChIKey=XDZYFDZJEANUFX-UHFFFAOYSA-N
SMILES:C1=2C(C3C=CC1CC3)=CC=CC2
Synonyms:- 1,4-Ethanonaphthalene, 1,4-dihydro-
- Benzobicyclo[2.2.2]octadiene
- 1,4-Dihydro-1,4-ethanonaphthalene
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
