CymitQuimica logo

CAS 73220-00-5

:

3,5-dibromo-N-{[(2R)-1-ethylpyrrolidin-2-yl]methyl}-2,6-dimethoxybenzamide

Description:
3,5-Dibromo-N-{[(2R)-1-ethylpyrrolidin-2-yl]methyl}-2,6-dimethoxybenzamide is a chemical compound characterized by its complex structure, which includes a benzamide core substituted with bromine and methoxy groups. The presence of the dibromo substituents at the 3 and 5 positions of the benzene ring enhances its reactivity and may influence its biological activity. The methoxy groups at the 2 and 6 positions contribute to the compound's lipophilicity, potentially affecting its solubility and permeability in biological systems. The pyrrolidine moiety, specifically in the (2R) configuration, introduces chirality, which can significantly impact the compound's pharmacological properties. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its CAS number, 73220-00-5, allows for easy identification in chemical databases. Overall, the unique combination of functional groups and stereochemistry in this compound suggests potential applications in therapeutic contexts, although specific biological effects would require further investigation.
Formula:C16H22Br2N2O3
InChI:InChI=1/C16H22Br2N2O3/c1-4-20-7-5-6-10(20)9-19-16(21)13-14(22-2)11(17)8-12(18)15(13)23-3/h8,10H,4-7,9H2,1-3H3,(H,19,21)/t10-/m1/s1
SMILES:CCN1CCC[C@@H]1CN=C(c1c(c(cc(c1OC)Br)Br)OC)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.