CAS 73221-18-8

imidazo[1,2-a]pyridin-8-amine

Description:

Imidazo[1,2-a]pyridin-8-amine is a heterocyclic organic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. This compound typically exhibits a molecular formula that includes nitrogen atoms, reflecting its basicity and potential for forming hydrogen bonds. It is often utilized in medicinal chemistry due to its biological activity, particularly in the development of pharmaceuticals targeting various diseases. The presence of the amino group at the 8-position enhances its reactivity and solubility in polar solvents. Imidazo[1,2-a]pyridin-8-amine may also participate in various chemical reactions, such as nucleophilic substitutions and coupling reactions, making it a versatile building block in organic synthesis. Additionally, its structural features allow for interactions with biological targets, which is of significant interest in drug discovery. Overall, this compound represents an important class of nitrogen-containing heterocycles with diverse applications in both research and industry.

Formula: C₇H₇N₃

InChI: InChI=1/C7H7N3/c8-6-2-1-4-10-5-3-9-7(6)10/h1-5H,8H2

SMILES: c1cc(c2nccn2c1)N

Imidazo[1,2-a]pyridin-8-ylamine

CAS: 73221-18-8

Formula: C₇H₇N₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 133.1506

Ref: IN-DA005Q08

8-Aminoimidazo[1,2-a]pyridine

CAS: 73221-18-8

8-Aminoimidazo[1,2-a]pyridine

Formula: C₇H₇N₃

Purity: 95%

Color and Shape: brown solid

Molecular weight: 133.15g/mol

Ref: 54-OR52051

Imidazo[1,2-a]pyridin-8-amine

CAS: 73221-18-8

Formula: C₇H₇N₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 133.154

Ref: 10-F065068

Imidazo[1,2-a]pyridin-8-ylamine dihydrochloride

CAS: 73221-18-8

Imidazo[1,2-a]pyridin-8-ylamine dihydrochloride is an arylation agent that reacts with nucleophiles to form an amide linkage. Imidazo[1,2-a]pyridin-8-ylamine dihydrochloride is used in the synthesis of carboxylic acid derivatives and other biomolecules. It can be used for selective functionalization of unsymmetrical carboxylic acids.

Formula: C₇H₇N₃·2HCl

Purity: Min. 95%

Molecular weight: 206.07 g/mol

Ref: 3D-FI51744