CAS 73221-20-2
:2-(Trifluoromethyl)imidazo[1,2-a]pyridine-8-carboxylic acid
Description:
2-(Trifluoromethyl)imidazo[1,2-a]pyridine-8-carboxylic acid is a heterocyclic compound characterized by its imidazo-pyridine structure, which incorporates a trifluoromethyl group and a carboxylic acid functional group. This compound typically exhibits a high degree of polarity due to the presence of the trifluoromethyl group, which can influence its solubility and reactivity. The imidazo[1,2-a]pyridine framework contributes to its potential biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The carboxylic acid moiety can participate in hydrogen bonding and may enhance the compound's interaction with biological targets. Additionally, the trifluoromethyl group is known to enhance metabolic stability and lipophilicity, which can be advantageous in drug design. Overall, this compound's unique structural features and functional groups make it a valuable candidate for further research in various chemical and biological applications.
Formula:C9H5F3N2O2
InChI:InChI=1S/C9H5F3N2O2/c10-9(11,12)6-4-14-3-1-2-5(8(15)16)7(14)13-6/h1-4H,(H,15,16)
InChI key:InChIKey=LSCPGFRSWFYTPL-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=2N(C=C(C(F)(F)F)N2)C=CC1
Synonyms:- 2-Trifluoromethylimidazo[1,2-a]pyridine-8-carboxylic acid
- Imidazo[1,2-a]pyridine-8-carboxylic acid, 2-(trifluoromethyl)-
- 2-(Trifluoromethyl)imidazo[1,2-a]pyridine-8-carboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.