CymitQuimica logo

CAS 73221-27-9

:

1,5,6,7-Tetrahydro-2-(trifluoromethyl)imidazo[1,2-a]pyrimidine

Description:
1,5,6,7-Tetrahydro-2-(trifluoromethyl)imidazo[1,2-a]pyrimidine is a heterocyclic organic compound characterized by its unique bicyclic structure, which incorporates both imidazole and pyrimidine rings. This compound features a trifluoromethyl group, which significantly influences its chemical properties, including increased lipophilicity and potential biological activity. The presence of the tetrahydro moiety indicates that the compound is saturated, contributing to its stability and solubility in various solvents. It is often studied for its potential applications in medicinal chemistry, particularly as a scaffold for developing pharmaceuticals due to its ability to interact with biological targets. The trifluoromethyl group can enhance the compound's metabolic stability and bioavailability. Additionally, the compound's CAS number, 73221-27-9, allows for easy identification and retrieval of information in chemical databases. Overall, this compound exemplifies the diverse functionalities that can be achieved through strategic molecular design in drug development.
Formula:C7H8F3N3
InChI:InChI=1S/C7H8F3N3/c8-7(9,10)5-4-13-3-1-2-11-6(13)12-5/h4H,1-3H2,(H,11,12)
InChI key:InChIKey=LMRFIUNEMHDWKX-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1=CN2C(N1)=NCCC2
Synonyms:
  • 2-(Trifluoromethyl)-5H,6H,7H,8H-imidazo[1,2-a]pyrimidine
  • Imidazo[1,2-a]pyrimidine, 1,5,6,7-tetrahydro-2-(trifluoromethyl)-
  • Imidazo[1,2-a]pyrimidine, 5,6,7,8-tetrahydro-2-(trifluoromethyl)-
  • 1,5,6,7-Tetrahydro-2-(trifluoromethyl)imidazo[1,2-a]pyrimidine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.