CAS 732248-41-8
:5-bromohex-5-enoic acid
Description:
5-Bromohex-5-enoic acid is an organic compound characterized by the presence of a bromine atom and a double bond within a hexanoic acid framework. It features a six-carbon chain with a double bond located at the fifth carbon, which contributes to its unsaturation. The presence of the carboxylic acid functional group (-COOH) at one end of the molecule imparts acidic properties, allowing it to participate in various chemical reactions, such as esterification and amidation. The bromine substituent enhances the compound's reactivity, making it useful in synthetic organic chemistry, particularly in the formation of more complex molecules. Additionally, the compound's structure suggests potential applications in pharmaceuticals and agrochemicals, where halogenated compounds often exhibit unique biological activities. Its physical properties, such as solubility and boiling point, are influenced by the molecular structure and functional groups present. Overall, 5-bromohex-5-enoic acid is a versatile compound with significant implications in chemical synthesis and research.
Formula:C6H9BrO2
InChI:InChI=1/C6H9BrO2/c1-5(7)3-2-4-6(8)9/h1-4H2,(H,8,9)
SMILES:C=C(CCCC(=O)O)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.