CAS 732248-47-4
:6-bromohept-6-enoic acid
Description:
6-Bromohept-6-enoic acid is an organic compound characterized by the presence of a bromine atom and a double bond in its heptenoic acid structure. It features a seven-carbon chain with a double bond located at the sixth carbon, which contributes to its unsaturation and reactivity. The bromine substituent at the sixth position can influence the compound's chemical behavior, making it a potential candidate for various synthetic applications, including in organic synthesis and medicinal chemistry. The carboxylic acid functional group at one end of the molecule imparts acidic properties, allowing it to participate in acid-base reactions. Additionally, the presence of both the double bond and the bromine atom can facilitate electrophilic addition reactions, making it useful in further chemical transformations. The compound's unique structure may also affect its physical properties, such as solubility and boiling point, which are important for its practical applications. Overall, 6-bromohept-6-enoic acid is a versatile compound with potential uses in various fields of chemistry.
Formula:C7H11BrO2
InChI:InChI=1/C7H11BrO2/c1-6(8)4-2-3-5-7(9)10/h1-5H2,(H,9,10)
SMILES:C=C(CCCCC(=O)O)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.