CymitQuimica logo

CAS 732248-52-1

:

7-bromooct-7-enoic acid

Description:
7-Bromooct-7-enoic acid is an organic compound characterized by the presence of a bromine atom and a double bond within its octanoic acid structure. The compound features a carboxylic acid functional group, which imparts acidic properties and enhances its reactivity in various chemical reactions. The presence of the double bond at the 7-position contributes to its unsaturation, influencing its physical properties such as boiling and melting points, as well as its reactivity in addition reactions. The bromine substituent can serve as a site for nucleophilic substitution, making the compound useful in synthetic organic chemistry. Additionally, the compound's structure suggests potential applications in the development of pharmaceuticals or agrochemicals, where the unique properties of the bromine atom and the unsaturated carbon chain can be exploited. As with many organic compounds, the solubility and stability of 7-bromooct-7-enoic acid can vary depending on the solvent and environmental conditions. Safety precautions should be observed when handling this compound due to the presence of bromine, which can be hazardous.
Formula:C8H13BrO2
InChI:InChI=1/C8H13BrO2/c1-7(9)5-3-2-4-6-8(10)11/h1-6H2,(H,10,11)
SMILES:C=C(CCCCCC(=O)O)Br
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.