CAS 732248-59-8
:8-bromonon-8-enoic acid
Description:
8-Bromonon-8-enoic acid is an organic compound characterized by the presence of a bromine atom and a double bond within its nonane carbon chain. As an unsaturated fatty acid, it features a carboxylic acid functional group (-COOH) at one end, which imparts acidic properties and allows for potential reactivity in various chemical reactions, such as esterification or amidation. The bromine substituent at the 8th carbon enhances its reactivity, making it useful in synthetic organic chemistry, particularly in the formation of carbon-carbon bonds or in substitution reactions. The presence of the double bond contributes to its geometric isomerism, potentially allowing for cis/trans configurations. This compound may exhibit moderate solubility in organic solvents and limited solubility in water, typical of many fatty acids. Its unique structure and functional groups make it a candidate for applications in pharmaceuticals, agrochemicals, or as an intermediate in organic synthesis. Safety precautions should be taken when handling this compound due to the presence of bromine, which can be hazardous.
Formula:C9H15BrO2
InChI:InChI=1/C9H15BrO2/c1-8(10)6-4-2-3-5-7-9(11)12/h1-7H2,(H,11,12)
SMILES:C=C(CCCCCCC(=O)O)Br
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.